C23H14F3N5O4 — CID 118234723
9-(6-methoxy-3-pyridinyl)-1-[3-(trifluoromethoxy)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 118234723) has the molecular formula C23H14F3N5O4 and a molecular weight of 481.39 g/mol. Its IUPAC name is 9-(6-methoxy-3-pyridinyl)-1-[3-(trifluoromethoxy)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 9-(6-methoxy-3-pyridinyl)-1-[3-(trifluoromethoxy)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 118234723 |
| Molecular Formula | C23H14F3N5O4 |
| Molecular Weight | 481.39 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | 9-(6-methoxy-3-pyridinyl)-1-[3-(trifluoromethoxy)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | COc1ccc(-c2ccc3ncc4c(=O)[nH]c(=O)n(-c5cccc(OC(F)(F)F)c5)c4c3n2)cn1 |
| InChI | InChI=1S/C23H14F3N5O4/c1-34-18-8-5-12(10-28-18)16-6-7-17-19(29-16)20-15(11-27-17)21(32)30-22(33)31(20)13-3-2-4-14(9-13)35-23(24,25)26/h2-11H,1H3,(H,30,32,33) |
| InChIKey | UIOFYTPEZLTKIN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|