C16H15Cl2F3N2O6 — CID 118238695
2-[methyl(2-nitrooxyethyl)amino]ethyl 6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 118238695) has the molecular formula C16H15Cl2F3N2O6 and a molecular weight of 459.20 g/mol. Its IUPAC name is 2-[methyl(2-nitrooxyethyl)amino]ethyl 6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 2-[methyl(2-nitrooxyethyl)amino]ethyl 6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 118238695 |
| Molecular Formula | C16H15Cl2F3N2O6 |
| Molecular Weight | 459.20 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | 2-[methyl(2-nitrooxyethyl)amino]ethyl 6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CN(CCOC(=O)C1=Cc2cc(Cl)cc(Cl)c2OC1C(F)(F)F)CCO[N+](=O)[O-] |
| InChI | InChI=1S/C16H15Cl2F3N2O6/c1-22(3-5-28-23(25)26)2-4-27-15(24)11-7-9-6-10(17)8-12(18)13(9)29-14(11)16(19,20)21/h6-8,14H,2-5H2,1H3 |
| InChIKey | SKPYIPZWEDNUAZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.20 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|