C15H15F3N2O6 — CID 118238764
[2-(2H-chromene-3-carbonylamino)-2-ethoxy-3,3,3-trifluoropropyl] nitrate (PubChem CID 118238764) has the molecular formula C15H15F3N2O6 and a molecular weight of 376.29 g/mol. Its IUPAC name is [2-(2H-chromene-3-carbonylamino)-2-ethoxy-3,3,3-trifluoropropyl] nitrate.
| Compound Name | [2-(2H-chromene-3-carbonylamino)-2-ethoxy-3,3,3-trifluoropropyl] nitrate |
|---|---|
| PubChem CID | 118238764 |
| Molecular Formula | C15H15F3N2O6 |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | [2-(2H-chromene-3-carbonylamino)-2-ethoxy-3,3,3-trifluoropropyl] nitrate |
| SMILES | CCOC(CO[N+](=O)[O-])(NC(=O)C1=Cc2ccccc2OC1)C(F)(F)F |
| InChI | InChI=1S/C15H15F3N2O6/c1-2-25-14(15(16,17)18,9-26-20(22)23)19-13(21)11-7-10-5-3-4-6-12(10)24-8-11/h3-7H,2,8-9H2,1H3,(H,19,21) |
| InChIKey | DBNIMMSTZFWUOO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|