C7H7F2NO3S — CID 118238808
N-(2,5-difluorophenyl)-N-hydroxymethanesulfonamide (PubChem CID 118238808) has the molecular formula C7H7F2NO3S and a molecular weight of 223.20 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-N-hydroxymethanesulfonamide.
| Compound Name | N-(2,5-difluorophenyl)-N-hydroxymethanesulfonamide |
|---|---|
| PubChem CID | 118238808 |
| Molecular Formula | C7H7F2NO3S |
| Molecular Weight | 223.20 g/mol |
| Exact Mass | 223.01 |
| IUPAC Name | N-(2,5-difluorophenyl)-N-hydroxymethanesulfonamide |
| SMILES | CS(=O)(=O)N(O)c1cc(F)ccc1F |
| InChI | InChI=1S/C7H7F2NO3S/c1-14(12,13)10(11)7-4-5(8)2-3-6(7)9/h2-4,11H,1H3 |
| InChIKey | TXOCFLZECPQWAX-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.20 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|