C22H23N7OS — CID 118239717
3-[6-methyl-4-(thiophen-2-ylmethylamino)-5,7,8,9-tetrahydropyrimido[5,4-c]azepin-2-yl]imidazo[1,5-a]pyridine-8-carboxamide (PubChem CID 118239717) has the molecular formula C22H23N7OS and a molecular weight of 433.54 g/mol. Its IUPAC name is 3-[6-methyl-4-(thiophen-2-ylmethylamino)-5,7,8,9-tetrahydropyrimido[5,4-c]azepin-2-yl]imidazo[1,5-a]pyridine-8-carboxamide.
| Compound Name | 3-[6-methyl-4-(thiophen-2-ylmethylamino)-5,7,8,9-tetrahydropyrimido[5,4-c]azepin-2-yl]imidazo[1,5-a]pyridine-8-carboxamide |
|---|---|
| PubChem CID | 118239717 |
| Molecular Formula | C22H23N7OS |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 3-[6-methyl-4-(thiophen-2-ylmethylamino)-5,7,8,9-tetrahydropyrimido[5,4-c]azepin-2-yl]imidazo[1,5-a]pyridine-8-carboxamide |
| SMILES | CN1CCCc2nc(-c3ncc4c(C(N)=O)cccn34)nc(NCc3cccs3)c2C1 |
| InChI | InChI=1S/C22H23N7OS/c1-28-8-3-7-17-16(13-28)20(24-11-14-5-4-10-31-14)27-21(26-17)22-25-12-18-15(19(23)30)6-2-9-29(18)22/h2,4-6,9-10,12H,3,7-8,11,13H2,1H3,(H2,23,30)(H,24,26,27) |
| InChIKey | CMVQFWOOWSQXES-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 101.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |