C22H23N7OS — CID 118240358
3-[9-methyl-4-(thiophen-2-ylmethylamino)-5,6,7,8-tetrahydropyrimido[4,5-b]azepin-2-yl]imidazo[1,5-a]pyridine-8-carboxamide (PubChem CID 118240358) has the molecular formula C22H23N7OS and a molecular weight of 433.54 g/mol. Its IUPAC name is 3-[9-methyl-4-(thiophen-2-ylmethylamino)-5,6,7,8-tetrahydropyrimido[4,5-b]azepin-2-yl]imidazo[1,5-a]pyridine-8-carboxamide.
| Compound Name | 3-[9-methyl-4-(thiophen-2-ylmethylamino)-5,6,7,8-tetrahydropyrimido[4,5-b]azepin-2-yl]imidazo[1,5-a]pyridine-8-carboxamide |
|---|---|
| PubChem CID | 118240358 |
| Molecular Formula | C22H23N7OS |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 3-[9-methyl-4-(thiophen-2-ylmethylamino)-5,6,7,8-tetrahydropyrimido[4,5-b]azepin-2-yl]imidazo[1,5-a]pyridine-8-carboxamide |
| SMILES | CN1CCCCc2c(NCc3cccs3)nc(-c3ncc4c(C(N)=O)cccn34)nc21 |
| InChI | InChI=1S/C22H23N7OS/c1-28-9-3-2-7-16-19(24-12-14-6-5-11-31-14)26-20(27-21(16)28)22-25-13-17-15(18(23)30)8-4-10-29(17)22/h4-6,8,10-11,13H,2-3,7,9,12H2,1H3,(H2,23,30)(H,24,26,27) |
| InChIKey | BEZUITHSNJMWAA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 101.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |