C14H30N2O3S — CID 118241891
4-methyl-4-[methyl(methylsulfonyl)amino]-N-propan-2-yl-2-propylpentanamide (PubChem CID 118241891) has the molecular formula C14H30N2O3S and a molecular weight of 306.47 g/mol. Its IUPAC name is 4-methyl-4-[methyl(methylsulfonyl)amino]-N-propan-2-yl-2-propylpentanamide.
| Compound Name | 4-methyl-4-[methyl(methylsulfonyl)amino]-N-propan-2-yl-2-propylpentanamide |
|---|---|
| PubChem CID | 118241891 |
| Molecular Formula | C14H30N2O3S |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 4-methyl-4-[methyl(methylsulfonyl)amino]-N-propan-2-yl-2-propylpentanamide |
| SMILES | CCCC(CC(C)(C)N(C)S(C)(=O)=O)C(=O)NC(C)C |
| InChI | InChI=1S/C14H30N2O3S/c1-8-9-12(13(17)15-11(2)3)10-14(4,5)16(6)20(7,18)19/h11-12H,8-10H2,1-7H3,(H,15,17) |
| InChIKey | KTFZZDSXJIAPKT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |