C18H13IN2O2S — CID 118242456
9-[4-(aminomethyl)phenyl]-8-hydroxy-6-iodo-5H-thieno[2,3-c]quinolin-4-one (PubChem CID 118242456) has the molecular formula C18H13IN2O2S and a molecular weight of 448.29 g/mol. Its IUPAC name is 9-[4-(aminomethyl)phenyl]-8-hydroxy-6-iodo-5H-thieno[2,3-c]quinolin-4-one.
| Compound Name | 9-[4-(aminomethyl)phenyl]-8-hydroxy-6-iodo-5H-thieno[2,3-c]quinolin-4-one |
|---|---|
| PubChem CID | 118242456 |
| Molecular Formula | C18H13IN2O2S |
| Molecular Weight | 448.29 g/mol |
| Exact Mass | 447.97 |
| IUPAC Name | 9-[4-(aminomethyl)phenyl]-8-hydroxy-6-iodo-5H-thieno[2,3-c]quinolin-4-one |
| SMILES | NCc1ccc(-c2c(O)cc(I)c3[nH]c(=O)c4sccc4c23)cc1 |
| InChI | InChI=1S/C18H13IN2O2S/c19-12-7-13(22)14(10-3-1-9(8-20)2-4-10)15-11-5-6-24-17(11)18(23)21-16(12)15/h1-7,22H,8,20H2,(H,21,23) |
| InChIKey | OSVOIJRAQNWIPK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.29 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|