C22H21BN2O2S — CID 163526212
CID 163526212 (PubChem CID 163526212) has the molecular formula C22H21BN2O2S and a molecular weight of 388.30 g/mol.
| Compound Name | CID 163526212 |
|---|---|
| PubChem CID | 163526212 |
| Molecular Formula | C22H21BN2O2S |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | — |
| SMILES | [B]c1cc(O)c(-c2ccc(CCCCCN)cc2)c2c1[nH]c(=O)c1sccc12 |
| InChI | InChI=1S/C22H21BN2O2S/c23-16-12-17(26)18(14-7-5-13(6-8-14)4-2-1-3-10-24)19-15-9-11-28-21(15)22(27)25-20(16)19/h5-9,11-12,26H,1-4,10,24H2,(H,25,27) |
| InChIKey | HCCCOBMIBCEINR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|