About 8-hydroxy-9-[4-(3-piperidin-1-ylpropyl)phenyl]-5H-thieno[2,3-c]quinolin-4-one
8-hydroxy-9-[4-(3-piperidin-1-ylpropyl)phenyl]-5H-thieno[2,3-c]quinolin-4-one (PubChem CID 158236634) has the molecular formula C25H26N2O2S
and a molecular weight of 418.56 g/mol. Its IUPAC name is 8-hydroxy-9-[4-(3-piperidin-1-ylpropyl)phenyl]-5H-thieno[2,3-c]quinolin-4-one.
Molecular Properties
| Compound Name | 8-hydroxy-9-[4-(3-piperidin-1-ylpropyl)phenyl]-5H-thieno[2,3-c]quinolin-4-one |
| PubChem CID | 158236634 |
| Molecular Formula | C25H26N2O2S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 8-hydroxy-9-[4-(3-piperidin-1-ylpropyl)phenyl]-5H-thieno[2,3-c]quinolin-4-one |
| SMILES | O=c1[nH]c2ccc(O)c(-c3ccc(CCCN4CCCCC4)cc3)c2c2ccsc12 |
| InChI | InChI=1S/C25H26N2O2S/c28-21-11-10-20-23(19-12-16-30-24(19)25(29)26-20)22(21)18-8-6-17(7-9-18)5-4-15-27-13-2-1-3-14-27/h6-12,16,28H,1-5,13-15H2,(H,26,29) |
| InChIKey | GFASMNXAIYRAOH-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-hydroxy-9-[4-(3-piperidin-1-ylpropyl)phenyl]-5H-thieno[2,3-c]quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydroxy-9-[4-(3-piperidin-1-ylpropyl)phenyl]-5H-thieno[2,3-c]quinolin-4-one?
The IUPAC name of 8-hydroxy-9-[4-(3-piperidin-1-ylpropyl)phenyl]-5H-thieno[2,3-c]quinolin-4-one (CID 158236634) is 8-hydroxy-9-[4-(3-piperidin-1-ylpropyl)phenyl]-5H-thieno[2,3-c]quinolin-4-one.
What is the SMILES notation for 8-hydroxy-9-[4-(3-piperidin-1-ylpropyl)phenyl]-5H-thieno[2,3-c]quinolin-4-one?
The canonical SMILES for 8-hydroxy-9-[4-(3-piperidin-1-ylpropyl)phenyl]-5H-thieno[2,3-c]quinolin-4-one is O=c1[nH]c2ccc(O)c(-c3ccc(CCCN4CCCCC4)cc3)c2c2ccsc12.
What is the InChIKey of 8-hydroxy-9-[4-(3-piperidin-1-ylpropyl)phenyl]-5H-thieno[2,3-c]quinolin-4-one?
The InChIKey is GFASMNXAIYRAOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26N2O2S/c28-21-11-10-20-23(19-12-16-30-24(19)25(29)26-20)22(21)18-8-6-17(7-9-18)5-4-15-27-13-2-1-3-14-27/h6-12,16,28H,1-5,13-15H2,(H,26,29).
What are the key properties of 8-hydroxy-9-[4-(3-piperidin-1-ylpropyl)phenyl]-5H-thieno[2,3-c]quinolin-4-one?
8-hydroxy-9-[4-(3-piperidin-1-ylpropyl)phenyl]-5H-thieno[2,3-c]quinolin-4-one has a molecular weight of 418.56 g/mol, XLogP of 5.53, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxy-9-[4-(3-piperidin-1-ylpropyl)phenyl]-5H-thieno[2,3-c]quinolin-4-one is sourced from PubChem (CID 158236634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).