C21H18N2O2S — CID 123968671
8-hydroxy-9-[4-[(propan-2-ylideneamino)methyl]phenyl]-5H-thieno[2,3-c]quinolin-4-one (PubChem CID 123968671) has the molecular formula C21H18N2O2S and a molecular weight of 362.45 g/mol. Its IUPAC name is 8-hydroxy-9-[4-[(propan-2-ylideneamino)methyl]phenyl]-5H-thieno[2,3-c]quinolin-4-one.
| Compound Name | 8-hydroxy-9-[4-[(propan-2-ylideneamino)methyl]phenyl]-5H-thieno[2,3-c]quinolin-4-one |
|---|---|
| PubChem CID | 123968671 |
| Molecular Formula | C21H18N2O2S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 8-hydroxy-9-[4-[(propan-2-ylideneamino)methyl]phenyl]-5H-thieno[2,3-c]quinolin-4-one |
| SMILES | CC(C)=NCc1ccc(-c2c(O)ccc3[nH]c(=O)c4sccc4c23)cc1 |
| InChI | InChI=1S/C21H18N2O2S/c1-12(2)22-11-13-3-5-14(6-4-13)18-17(24)8-7-16-19(18)15-9-10-26-20(15)21(25)23-16/h3-10,24H,11H2,1-2H3,(H,23,25) |
| InChIKey | UCYARYHNXLWBSA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 65.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|