C17H9ClFNO2S — CID 53472668
9-(4-chloro-3-fluorophenyl)-8-hydroxy-5H-thieno[2,3-c]quinolin-4-one (PubChem CID 53472668) has the molecular formula C17H9ClFNO2S and a molecular weight of 345.78 g/mol. Its IUPAC name is 9-(4-chloro-3-fluorophenyl)-8-hydroxy-5H-thieno[2,3-c]quinolin-4-one.
| Compound Name | 9-(4-chloro-3-fluorophenyl)-8-hydroxy-5H-thieno[2,3-c]quinolin-4-one |
|---|---|
| PubChem CID | 53472668 |
| Molecular Formula | C17H9ClFNO2S |
| Molecular Weight | 345.78 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 9-(4-chloro-3-fluorophenyl)-8-hydroxy-5H-thieno[2,3-c]quinolin-4-one |
| SMILES | O=c1[nH]c2ccc(O)c(-c3ccc(Cl)c(F)c3)c2c2ccsc12 |
| InChI | InChI=1S/C17H9ClFNO2S/c18-10-2-1-8(7-11(10)19)14-13(21)4-3-12-15(14)9-5-6-23-16(9)17(22)20-12/h1-7,21H,(H,20,22) |
| InChIKey | KEGONDKQNSQDHW-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.78 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |