C18H13N2O4S2- — CID 118234989
8-hydroxy-4-oxo-9-[4-[(sulfinatoamino)methyl]phenyl]-5H-thieno[2,3-c]quinoline (PubChem CID 118234989) has the molecular formula C18H13N2O4S2- and a molecular weight of 385.45 g/mol. Its IUPAC name is 8-hydroxy-4-oxo-9-[4-[(sulfinatoamino)methyl]phenyl]-5H-thieno[2,3-c]quinoline.
| Compound Name | 8-hydroxy-4-oxo-9-[4-[(sulfinatoamino)methyl]phenyl]-5H-thieno[2,3-c]quinoline |
|---|---|
| PubChem CID | 118234989 |
| Molecular Formula | C18H13N2O4S2- |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 8-hydroxy-4-oxo-9-[4-[(sulfinatoamino)methyl]phenyl]-5H-thieno[2,3-c]quinoline |
| SMILES | O=c1[nH]c2ccc(O)c(-c3ccc(CNS(=O)[O-])cc3)c2c2ccsc12 |
| InChI | InChI=1S/C18H14N2O4S2/c21-14-6-5-13-16(12-7-8-25-17(12)18(22)20-13)15(14)11-3-1-10(2-4-11)9-19-26(23)24/h1-8,19,21H,9H2,(H,20,22)(H,23,24)/p-1 |
| InChIKey | IPWPFPCVRZOUNI-UHFFFAOYSA-M |
| XLogP | 3.00 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|