C21H20N2O2S — CID 67450179
9-[4-(ethylaminomethyl)phenyl]-8-methoxy-5H-thieno[2,3-c]quinolin-4-one (PubChem CID 67450179) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is 9-[4-(ethylaminomethyl)phenyl]-8-methoxy-5H-thieno[2,3-c]quinolin-4-one.
| Compound Name | 9-[4-(ethylaminomethyl)phenyl]-8-methoxy-5H-thieno[2,3-c]quinolin-4-one |
|---|---|
| PubChem CID | 67450179 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 9-[4-(ethylaminomethyl)phenyl]-8-methoxy-5H-thieno[2,3-c]quinolin-4-one |
| SMILES | CCNCc1ccc(-c2c(OC)ccc3[nH]c(=O)c4sccc4c23)cc1 |
| InChI | InChI=1S/C21H20N2O2S/c1-3-22-12-13-4-6-14(7-5-13)18-17(25-2)9-8-16-19(18)15-10-11-26-20(15)21(24)23-16/h4-11,22H,3,12H2,1-2H3,(H,23,24) |
| InChIKey | PZEQOFCNWJMLFQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |