C22H22N2O2S — CID 163590116
9-[4-(1-aminobutyl)phenyl]-8-methoxy-5H-thieno[2,3-c]quinolin-4-one (PubChem CID 163590116) has the molecular formula C22H22N2O2S and a molecular weight of 378.50 g/mol. Its IUPAC name is 9-[4-(1-aminobutyl)phenyl]-8-methoxy-5H-thieno[2,3-c]quinolin-4-one.
| Compound Name | 9-[4-(1-aminobutyl)phenyl]-8-methoxy-5H-thieno[2,3-c]quinolin-4-one |
|---|---|
| PubChem CID | 163590116 |
| Molecular Formula | C22H22N2O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 9-[4-(1-aminobutyl)phenyl]-8-methoxy-5H-thieno[2,3-c]quinolin-4-one |
| SMILES | CCCC(N)c1ccc(-c2c(OC)ccc3[nH]c(=O)c4sccc4c23)cc1 |
| InChI | InChI=1S/C22H22N2O2S/c1-3-4-16(23)13-5-7-14(8-6-13)19-18(26-2)10-9-17-20(19)15-11-12-27-21(15)22(25)24-17/h5-12,16H,3-4,23H2,1-2H3,(H,24,25) |
| InChIKey | GOUVVCROOHNURG-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |