C20H18N2O4S2 — CID 67450131
1-[4-(8-methoxy-4-oxo-5H-thieno[2,3-c]quinolin-9-yl)phenyl]ethanesulfonamide (PubChem CID 67450131) has the molecular formula C20H18N2O4S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 1-[4-(8-methoxy-4-oxo-5H-thieno[2,3-c]quinolin-9-yl)phenyl]ethanesulfonamide.
| Compound Name | 1-[4-(8-methoxy-4-oxo-5H-thieno[2,3-c]quinolin-9-yl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 67450131 |
| Molecular Formula | C20H18N2O4S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 1-[4-(8-methoxy-4-oxo-5H-thieno[2,3-c]quinolin-9-yl)phenyl]ethanesulfonamide |
| SMILES | COc1ccc2[nH]c(=O)c3sccc3c2c1-c1ccc(C(C)S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C20H18N2O4S2/c1-11(28(21,24)25)12-3-5-13(6-4-12)17-16(26-2)8-7-15-18(17)14-9-10-27-19(14)20(23)22-15/h3-11H,1-2H3,(H,22,23)(H2,21,24,25) |
| InChIKey | NLOKVUFMJSVOFI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 102.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |