C21H20N2O7S3 — CID 86689549
2-[[4-(8-methoxy-4-oxo-5H-thieno[2,3-c]quinolin-9-yl)phenyl]sulfonylamino]ethyl methanesulfonate (PubChem CID 86689549) has the molecular formula C21H20N2O7S3 and a molecular weight of 508.60 g/mol. Its IUPAC name is 2-[[4-(8-methoxy-4-oxo-5H-thieno[2,3-c]quinolin-9-yl)phenyl]sulfonylamino]ethyl methanesulfonate.
| Compound Name | 2-[[4-(8-methoxy-4-oxo-5H-thieno[2,3-c]quinolin-9-yl)phenyl]sulfonylamino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 86689549 |
| Molecular Formula | C21H20N2O7S3 |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.04 |
| IUPAC Name | 2-[[4-(8-methoxy-4-oxo-5H-thieno[2,3-c]quinolin-9-yl)phenyl]sulfonylamino]ethyl methanesulfonate |
| SMILES | COc1ccc2[nH]c(=O)c3sccc3c2c1-c1ccc(S(=O)(=O)NCCOS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H20N2O7S3/c1-29-17-8-7-16-19(15-9-12-31-20(15)21(24)23-16)18(17)13-3-5-14(6-4-13)33(27,28)22-10-11-30-32(2,25)26/h3-9,12,22H,10-11H2,1-2H3,(H,23,24) |
| InChIKey | JDEYEUDYDZJNQZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 131.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|