C21H19FN2O6S3 — CID 118194201
[9-[3-[2-fluoro-2-(methanesulfonamido)ethyl]phenyl]-4-oxo-5H-thieno[2,3-c]quinolin-8-yl] methanesulfonate (PubChem CID 118194201) has the molecular formula C21H19FN2O6S3 and a molecular weight of 510.59 g/mol. Its IUPAC name is [9-[3-[2-fluoro-2-(methanesulfonamido)ethyl]phenyl]-4-oxo-5H-thieno[2,3-c]quinolin-8-yl] methanesulfonate.
| Compound Name | [9-[3-[2-fluoro-2-(methanesulfonamido)ethyl]phenyl]-4-oxo-5H-thieno[2,3-c]quinolin-8-yl] methanesulfonate |
|---|---|
| PubChem CID | 118194201 |
| Molecular Formula | C21H19FN2O6S3 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.04 |
| IUPAC Name | [9-[3-[2-fluoro-2-(methanesulfonamido)ethyl]phenyl]-4-oxo-5H-thieno[2,3-c]quinolin-8-yl] methanesulfonate |
| SMILES | CS(=O)(=O)NC(F)Cc1cccc(-c2c(OS(C)(=O)=O)ccc3[nH]c(=O)c4sccc4c23)c1 |
| InChI | InChI=1S/C21H19FN2O6S3/c1-32(26,27)24-17(22)11-12-4-3-5-13(10-12)18-16(30-33(2,28)29)7-6-15-19(18)14-8-9-31-20(14)21(25)23-15/h3-10,17,24H,11H2,1-2H3,(H,23,25) |
| InChIKey | VDCCFNYAQSPYJF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 122.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|