C18H14N2O5S2 — CID 67450562
N-[2-hydroxy-4-(8-hydroxy-4-oxo-5H-thieno[2,3-c]quinolin-9-yl)phenyl]methanesulfonamide (PubChem CID 67450562) has the molecular formula C18H14N2O5S2 and a molecular weight of 402.45 g/mol. Its IUPAC name is N-[2-hydroxy-4-(8-hydroxy-4-oxo-5H-thieno[2,3-c]quinolin-9-yl)phenyl]methanesulfonamide.
| Compound Name | N-[2-hydroxy-4-(8-hydroxy-4-oxo-5H-thieno[2,3-c]quinolin-9-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 67450562 |
| Molecular Formula | C18H14N2O5S2 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | N-[2-hydroxy-4-(8-hydroxy-4-oxo-5H-thieno[2,3-c]quinolin-9-yl)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(-c2c(O)ccc3[nH]c(=O)c4sccc4c23)cc1O |
| InChI | InChI=1S/C18H14N2O5S2/c1-27(24,25)20-11-3-2-9(8-14(11)22)15-13(21)5-4-12-16(15)10-6-7-26-17(10)18(23)19-12/h2-8,20-22H,1H3,(H,19,23) |
| InChIKey | YJXHWAFWZCMTHP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|