C25H27NO4S2 — CID 123910794
9-[4-(5,5-dimethylhexylsulfonyl)phenyl]-8-hydroxy-5H-thieno[2,3-c]quinolin-4-one (PubChem CID 123910794) has the molecular formula C25H27NO4S2 and a molecular weight of 469.63 g/mol. Its IUPAC name is 9-[4-(5,5-dimethylhexylsulfonyl)phenyl]-8-hydroxy-5H-thieno[2,3-c]quinolin-4-one.
| Compound Name | 9-[4-(5,5-dimethylhexylsulfonyl)phenyl]-8-hydroxy-5H-thieno[2,3-c]quinolin-4-one |
|---|---|
| PubChem CID | 123910794 |
| Molecular Formula | C25H27NO4S2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 9-[4-(5,5-dimethylhexylsulfonyl)phenyl]-8-hydroxy-5H-thieno[2,3-c]quinolin-4-one |
| SMILES | CC(C)(C)CCCCS(=O)(=O)c1ccc(-c2c(O)ccc3[nH]c(=O)c4sccc4c23)cc1 |
| InChI | InChI=1S/C25H27NO4S2/c1-25(2,3)13-4-5-15-32(29,30)17-8-6-16(7-9-17)21-20(27)11-10-19-22(21)18-12-14-31-23(18)24(28)26-19/h6-12,14,27H,4-5,13,15H2,1-3H3,(H,26,28) |
| InChIKey | FUNNEESOJYTEPO-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 87.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|