C18H10N2O2S — CID 67449491
4-(8-hydroxy-4-oxo-5H-thieno[2,3-c]quinolin-9-yl)benzonitrile (PubChem CID 67449491) has the molecular formula C18H10N2O2S and a molecular weight of 318.36 g/mol. Its IUPAC name is 4-(8-hydroxy-4-oxo-5H-thieno[2,3-c]quinolin-9-yl)benzonitrile.
| Compound Name | 4-(8-hydroxy-4-oxo-5H-thieno[2,3-c]quinolin-9-yl)benzonitrile |
|---|---|
| PubChem CID | 67449491 |
| Molecular Formula | C18H10N2O2S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 4-(8-hydroxy-4-oxo-5H-thieno[2,3-c]quinolin-9-yl)benzonitrile |
| SMILES | N#Cc1ccc(-c2c(O)ccc3[nH]c(=O)c4sccc4c23)cc1 |
| InChI | InChI=1S/C18H10N2O2S/c19-9-10-1-3-11(4-2-10)15-14(21)6-5-13-16(15)12-7-8-23-17(12)18(22)20-13/h1-8,21H,(H,20,22) |
| InChIKey | KCFYWMBKFIZTLB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |