C21H20N2O3S2 — CID 88898499
8-hydroxy-9-[4-[1-[(methyl-methylidene-oxo-λ6-sulfanyl)amino]ethyl]phenyl]-5H-thieno[2,3-c]quinolin-4-one (PubChem CID 88898499) has the molecular formula C21H20N2O3S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is 8-hydroxy-9-[4-[1-[(methyl-methylidene-oxo-λ6-sulfanyl)amino]ethyl]phenyl]-5H-thieno[2,3-c]quinolin-4-one.
| Compound Name | 8-hydroxy-9-[4-[1-[(methyl-methylidene-oxo-λ6-sulfanyl)amino]ethyl]phenyl]-5H-thieno[2,3-c]quinolin-4-one |
|---|---|
| PubChem CID | 88898499 |
| Molecular Formula | C21H20N2O3S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 8-hydroxy-9-[4-[1-[(methyl-methylidene-oxo-λ6-sulfanyl)amino]ethyl]phenyl]-5H-thieno[2,3-c]quinolin-4-one |
| SMILES | C=S(C)(=O)NC(C)c1ccc(-c2c(O)ccc3[nH]c(=O)c4sccc4c23)cc1 |
| InChI | InChI=1S/C21H20N2O3S2/c1-12(23-28(2,3)26)13-4-6-14(7-5-13)18-17(24)9-8-16-19(18)15-10-11-27-20(15)21(25)22-16/h4-12,24H,2H2,1,3H3,(H,22,25)(H,23,26) |
| InChIKey | LRQMHJNXWXVTGG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|