C18H26N4O2 — CID 118242482
5-(2-methoxyethylamino)-1-methyl-N-(6-tricyclo[5.2.1.04,8]dec-3-enyl)pyrazole-4-carboxamide (PubChem CID 118242482) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 5-(2-methoxyethylamino)-1-methyl-N-(6-tricyclo[5.2.1.04,8]dec-3-enyl)pyrazole-4-carboxamide.
| Compound Name | 5-(2-methoxyethylamino)-1-methyl-N-(6-tricyclo[5.2.1.04,8]dec-3-enyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 118242482 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 5-(2-methoxyethylamino)-1-methyl-N-(6-tricyclo[5.2.1.04,8]dec-3-enyl)pyrazole-4-carboxamide |
| SMILES | COCCNc1c(C(=O)NC2CC3=CCC4CC3C2C4)cnn1C |
| InChI | InChI=1S/C18H26N4O2/c1-22-17(19-5-6-24-2)15(10-20-22)18(23)21-16-9-12-4-3-11-7-13(12)14(16)8-11/h4,10-11,13-14,16,19H,3,5-9H2,1-2H3,(H,21,23) |
| InChIKey | HFGMPUTVNNCSDZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|