C21H22N2O3 — CID 1182440
(3R)-3-(3,4-dihydro-2H-quinolin-1-yl)-1-(2-ethoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 1182440) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is (3R)-3-(3,4-dihydro-2H-quinolin-1-yl)-1-(2-ethoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(3,4-dihydro-2H-quinolin-1-yl)-1-(2-ethoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1182440 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (3R)-3-(3,4-dihydro-2H-quinolin-1-yl)-1-(2-ethoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | CCOc1ccccc1N1C(=O)C[C@@H](N2CCCc3ccccc32)C1=O |
| InChI | InChI=1S/C21H22N2O3/c1-2-26-19-12-6-5-11-17(19)23-20(24)14-18(21(23)25)22-13-7-9-15-8-3-4-10-16(15)22/h3-6,8,10-12,18H,2,7,9,13-14H2,1H3/t18-/m1/s1 |
| InChIKey | OZNNSALVFLXTMW-GOSISDBHSA-N |
| XLogP | 3.17 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|