C28H51N3O8 — CID 118245597
ethyl 2-[2-[2-[bis(2-ethoxy-2-oxoethyl)amino]ethyl-propylamino]ethyl-(2-ethoxy-2-oxoethyl)amino]-2-ethylpent-4-enoate (PubChem CID 118245597) has the molecular formula C28H51N3O8 and a molecular weight of 557.73 g/mol. Its IUPAC name is ethyl 2-[2-[2-[bis(2-ethoxy-2-oxoethyl)amino]ethyl-propylamino]ethyl-(2-ethoxy-2-oxoethyl)amino]-2-ethylpent-4-enoate.
| Compound Name | ethyl 2-[2-[2-[bis(2-ethoxy-2-oxoethyl)amino]ethyl-propylamino]ethyl-(2-ethoxy-2-oxoethyl)amino]-2-ethylpent-4-enoate |
|---|---|
| PubChem CID | 118245597 |
| Molecular Formula | C28H51N3O8 |
| Molecular Weight | 557.73 g/mol |
| Exact Mass | 557.37 |
| IUPAC Name | ethyl 2-[2-[2-[bis(2-ethoxy-2-oxoethyl)amino]ethyl-propylamino]ethyl-(2-ethoxy-2-oxoethyl)amino]-2-ethylpent-4-enoate |
| SMILES | C=CCC(CC)(C(=O)OCC)N(CCN(CCC)CCN(CC(=O)OCC)CC(=O)OCC)CC(=O)OCC |
| InChI | InChI=1S/C28H51N3O8/c1-8-15-28(10-3,27(35)39-14-7)31(23-26(34)38-13-6)20-19-29(16-9-2)17-18-30(21-24(32)36-11-4)22-25(33)37-12-5/h8H,1,9-23H2,2-7H3 |
| InChIKey | PMHQXFIAVXGEDW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 114.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.73 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|