C29H51N3O10 — CID 176591216
diethyl 2-[2-[2-[bis(2-ethoxy-2-oxoethyl)amino]ethyl-propylamino]ethyl-(2-ethoxy-2-oxoethyl)amino]-2-prop-2-enylpropanedioate (PubChem CID 176591216) has the molecular formula C29H51N3O10 and a molecular weight of 601.74 g/mol. Its IUPAC name is diethyl 2-[2-[2-[bis(2-ethoxy-2-oxoethyl)amino]ethyl-propylamino]ethyl-(2-ethoxy-2-oxoethyl)amino]-2-prop-2-enylpropanedioate.
| Compound Name | diethyl 2-[2-[2-[bis(2-ethoxy-2-oxoethyl)amino]ethyl-propylamino]ethyl-(2-ethoxy-2-oxoethyl)amino]-2-prop-2-enylpropanedioate |
|---|---|
| PubChem CID | 176591216 |
| Molecular Formula | C29H51N3O10 |
| Molecular Weight | 601.74 g/mol |
| Exact Mass | 601.36 |
| IUPAC Name | diethyl 2-[2-[2-[bis(2-ethoxy-2-oxoethyl)amino]ethyl-propylamino]ethyl-(2-ethoxy-2-oxoethyl)amino]-2-prop-2-enylpropanedioate |
| SMILES | C=CCC(C(=O)OCC)(C(=O)OCC)N(CCN(CCC)CCN(CC(=O)OCC)CC(=O)OCC)CC(=O)OCC |
| InChI | InChI=1S/C29H51N3O10/c1-8-15-29(27(36)41-13-6,28(37)42-14-7)32(23-26(35)40-12-5)20-19-30(16-9-2)17-18-31(21-24(33)38-10-3)22-25(34)39-11-4/h8H,1,9-23H2,2-7H3 |
| InChIKey | ZTCYWHJRBMKFKF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 141.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.74 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|