C16H14FN5 — CID 118246150
4-[(7-amino-3-methylbenzimidazol-5-yl)-methylamino]-3-fluorobenzonitrile (PubChem CID 118246150) has the molecular formula C16H14FN5 and a molecular weight of 295.32 g/mol. Its IUPAC name is 4-[(7-amino-3-methylbenzimidazol-5-yl)-methylamino]-3-fluorobenzonitrile.
| Compound Name | 4-[(7-amino-3-methylbenzimidazol-5-yl)-methylamino]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 118246150 |
| Molecular Formula | C16H14FN5 |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 4-[(7-amino-3-methylbenzimidazol-5-yl)-methylamino]-3-fluorobenzonitrile |
| SMILES | CN(c1cc(N)c2ncn(C)c2c1)c1ccc(C#N)cc1F |
| InChI | InChI=1S/C16H14FN5/c1-21-9-20-16-13(19)6-11(7-15(16)21)22(2)14-4-3-10(8-18)5-12(14)17/h3-7,9H,19H2,1-2H3 |
| InChIKey | VFNWNVXGMVLRSG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 70.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|