C17H17NO4S2 — CID 11824629
methyl 2-[(4-methylphenyl)sulfonylamino]-5-thiophen-2-ylpent-4-ynoate (PubChem CID 11824629) has the molecular formula C17H17NO4S2 and a molecular weight of 363.46 g/mol. Its IUPAC name is methyl 2-[(4-methylphenyl)sulfonylamino]-5-thiophen-2-ylpent-4-ynoate.
| Compound Name | methyl 2-[(4-methylphenyl)sulfonylamino]-5-thiophen-2-ylpent-4-ynoate |
|---|---|
| PubChem CID | 11824629 |
| Molecular Formula | C17H17NO4S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | methyl 2-[(4-methylphenyl)sulfonylamino]-5-thiophen-2-ylpent-4-ynoate |
| SMILES | COC(=O)C(CC#Cc1cccs1)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H17NO4S2/c1-13-8-10-15(11-9-13)24(20,21)18-16(17(19)22-2)7-3-5-14-6-4-12-23-14/h4,6,8-12,16,18H,7H2,1-2H3 |
| InChIKey | PPYHJVXESNXQSC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|