C17H20Cl2N6OS — CID 118247768
(4S)-8-[6-amino-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]pyrazin-2-yl]-2-oxa-8-azaspiro[4.5]decan-4-amine (PubChem CID 118247768) has the molecular formula C17H20Cl2N6OS and a molecular weight of 427.36 g/mol. Its IUPAC name is (4S)-8-[6-amino-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]pyrazin-2-yl]-2-oxa-8-azaspiro[4.5]decan-4-amine.
| Compound Name | (4S)-8-[6-amino-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]pyrazin-2-yl]-2-oxa-8-azaspiro[4.5]decan-4-amine |
|---|---|
| PubChem CID | 118247768 |
| Molecular Formula | C17H20Cl2N6OS |
| Molecular Weight | 427.36 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | (4S)-8-[6-amino-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]pyrazin-2-yl]-2-oxa-8-azaspiro[4.5]decan-4-amine |
| SMILES | Nc1nc(N2CCC3(CC2)COC[C@H]3N)cnc1Sc1ccnc(Cl)c1Cl |
| InChI | InChI=1S/C17H20Cl2N6OS/c18-13-10(1-4-22-14(13)19)27-16-15(21)24-12(7-23-16)25-5-2-17(3-6-25)9-26-8-11(17)20/h1,4,7,11H,2-3,5-6,8-9,20H2,(H2,21,24)/t11-/m1/s1 |
| InChIKey | PXJSAOOEAFJXNW-LLVKDONJSA-N |
| XLogP | 2.86 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|