C17H20F3N5S — CID 118248912
6-(4-amino-4-methylpiperidin-1-yl)-3-[2-(trifluoromethyl)phenyl]sulfanylpyrazin-2-amine (PubChem CID 118248912) has the molecular formula C17H20F3N5S and a molecular weight of 383.44 g/mol. Its IUPAC name is 6-(4-amino-4-methylpiperidin-1-yl)-3-[2-(trifluoromethyl)phenyl]sulfanylpyrazin-2-amine.
| Compound Name | 6-(4-amino-4-methylpiperidin-1-yl)-3-[2-(trifluoromethyl)phenyl]sulfanylpyrazin-2-amine |
|---|---|
| PubChem CID | 118248912 |
| Molecular Formula | C17H20F3N5S |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 6-(4-amino-4-methylpiperidin-1-yl)-3-[2-(trifluoromethyl)phenyl]sulfanylpyrazin-2-amine |
| SMILES | CC1(N)CCN(c2cnc(Sc3ccccc3C(F)(F)F)c(N)n2)CC1 |
| InChI | InChI=1S/C17H20F3N5S/c1-16(22)6-8-25(9-7-16)13-10-23-15(14(21)24-13)26-12-5-3-2-4-11(12)17(18,19)20/h2-5,10H,6-9,22H2,1H3,(H2,21,24) |
| InChIKey | QYXCFZQRLROSRX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |