C17H21F3N6S — CID 118248940
6-(4-amino-4-methylpiperidin-1-yl)-3-[3-amino-2-(trifluoromethyl)phenyl]sulfanylpyrazin-2-amine (PubChem CID 118248940) has the molecular formula C17H21F3N6S and a molecular weight of 398.46 g/mol. Its IUPAC name is 6-(4-amino-4-methylpiperidin-1-yl)-3-[3-amino-2-(trifluoromethyl)phenyl]sulfanylpyrazin-2-amine.
| Compound Name | 6-(4-amino-4-methylpiperidin-1-yl)-3-[3-amino-2-(trifluoromethyl)phenyl]sulfanylpyrazin-2-amine |
|---|---|
| PubChem CID | 118248940 |
| Molecular Formula | C17H21F3N6S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 6-(4-amino-4-methylpiperidin-1-yl)-3-[3-amino-2-(trifluoromethyl)phenyl]sulfanylpyrazin-2-amine |
| SMILES | CC1(N)CCN(c2cnc(Sc3cccc(N)c3C(F)(F)F)c(N)n2)CC1 |
| InChI | InChI=1S/C17H21F3N6S/c1-16(23)5-7-26(8-6-16)12-9-24-15(14(22)25-12)27-11-4-2-3-10(21)13(11)17(18,19)20/h2-4,9H,5-8,21,23H2,1H3,(H2,22,25) |
| InChIKey | HQYAENORLOJPMJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|