C27H19ClF2N6O2S — CID 118249279
N-[2-chloro-4-methyl-5-[2-[(2-phenylpyrimidin-4-yl)amino]-4-pyridinyl]-3-pyridinyl]-2,4-difluorobenzenesulfonamide (PubChem CID 118249279) has the molecular formula C27H19ClF2N6O2S and a molecular weight of 565.01 g/mol. Its IUPAC name is N-[2-chloro-4-methyl-5-[2-[(2-phenylpyrimidin-4-yl)amino]-4-pyridinyl]-3-pyridinyl]-2,4-difluorobenzenesulfonamide.
| Compound Name | N-[2-chloro-4-methyl-5-[2-[(2-phenylpyrimidin-4-yl)amino]-4-pyridinyl]-3-pyridinyl]-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 118249279 |
| Molecular Formula | C27H19ClF2N6O2S |
| Molecular Weight | 565.01 g/mol |
| Exact Mass | 564.09 |
| IUPAC Name | N-[2-chloro-4-methyl-5-[2-[(2-phenylpyrimidin-4-yl)amino]-4-pyridinyl]-3-pyridinyl]-2,4-difluorobenzenesulfonamide |
| SMILES | Cc1c(-c2ccnc(Nc3ccnc(-c4ccccc4)n3)c2)cnc(Cl)c1NS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C27H19ClF2N6O2S/c1-16-20(15-33-26(28)25(16)36-39(37,38)22-8-7-19(29)14-21(22)30)18-9-11-31-24(13-18)34-23-10-12-32-27(35-23)17-5-3-2-4-6-17/h2-15,36H,1H3,(H,31,32,34,35) |
| InChIKey | XQHUJGFZLNBKMN-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.01 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|