About N-(4-methylphenyl)-N'-[2-(1-phenylmethoxypyrazol-4-yl)phenyl]methanediimine
N-(4-methylphenyl)-N'-[2-(1-phenylmethoxypyrazol-4-yl)phenyl]methanediimine (PubChem CID 11825063) has the molecular formula C24H20N4O
and a molecular weight of 380.45 g/mol. Its IUPAC name is N-(4-methylphenyl)-N'-[2-(1-phenylmethoxypyrazol-4-yl)phenyl]methanediimine.
Molecular Properties
| Compound Name | N-(4-methylphenyl)-N'-[2-(1-phenylmethoxypyrazol-4-yl)phenyl]methanediimine |
| PubChem CID | 11825063 |
| Molecular Formula | C24H20N4O |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | N-(4-methylphenyl)-N'-[2-(1-phenylmethoxypyrazol-4-yl)phenyl]methanediimine |
| SMILES | Cc1ccc(N=C=Nc2ccccc2-c2cnn(OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C24H20N4O/c1-19-11-13-22(14-12-19)25-18-26-24-10-6-5-9-23(24)21-15-27-28(16-21)29-17-20-7-3-2-4-8-20/h2-16H,17H2,1H3 |
| InChIKey | DYFSLCDCCBZGLQ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 51.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(4-methylphenyl)-N'-[2-(1-phenylmethoxypyrazol-4-yl)phenyl]methanediimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methylphenyl)-N'-[2-(1-phenylmethoxypyrazol-4-yl)phenyl]methanediimine?
The IUPAC name of N-(4-methylphenyl)-N'-[2-(1-phenylmethoxypyrazol-4-yl)phenyl]methanediimine (CID 11825063) is N-(4-methylphenyl)-N'-[2-(1-phenylmethoxypyrazol-4-yl)phenyl]methanediimine.
What is the SMILES notation for N-(4-methylphenyl)-N'-[2-(1-phenylmethoxypyrazol-4-yl)phenyl]methanediimine?
The canonical SMILES for N-(4-methylphenyl)-N'-[2-(1-phenylmethoxypyrazol-4-yl)phenyl]methanediimine is Cc1ccc(N=C=Nc2ccccc2-c2cnn(OCc3ccccc3)c2)cc1.
What is the InChIKey of N-(4-methylphenyl)-N'-[2-(1-phenylmethoxypyrazol-4-yl)phenyl]methanediimine?
The InChIKey is DYFSLCDCCBZGLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20N4O/c1-19-11-13-22(14-12-19)25-18-26-24-10-6-5-9-23(24)21-15-27-28(16-21)29-17-20-7-3-2-4-8-20/h2-16H,17H2,1H3.
What are the key properties of N-(4-methylphenyl)-N'-[2-(1-phenylmethoxypyrazol-4-yl)phenyl]methanediimine?
N-(4-methylphenyl)-N'-[2-(1-phenylmethoxypyrazol-4-yl)phenyl]methanediimine has a molecular weight of 380.45 g/mol, XLogP of 5.62, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methylphenyl)-N'-[2-(1-phenylmethoxypyrazol-4-yl)phenyl]methanediimine is sourced from PubChem (CID 11825063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).