C27H36N2O4 — CID 118254805
1-azabicyclo[2.2.2]octan-3-yl-[2-[3-[4-(2-methoxyethoxymethyl)phenyl]phenyl]propan-2-yl]carbamic acid (PubChem CID 118254805) has the molecular formula C27H36N2O4 and a molecular weight of 452.60 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-3-yl-[2-[3-[4-(2-methoxyethoxymethyl)phenyl]phenyl]propan-2-yl]carbamic acid.
| Compound Name | 1-azabicyclo[2.2.2]octan-3-yl-[2-[3-[4-(2-methoxyethoxymethyl)phenyl]phenyl]propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 118254805 |
| Molecular Formula | C27H36N2O4 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-3-yl-[2-[3-[4-(2-methoxyethoxymethyl)phenyl]phenyl]propan-2-yl]carbamic acid |
| SMILES | COCCOCc1ccc(-c2cccc(C(C)(C)N(C(=O)O)C3CN4CCC3CC4)c2)cc1 |
| InChI | InChI=1S/C27H36N2O4/c1-27(2,29(26(30)31)25-18-28-13-11-22(25)12-14-28)24-6-4-5-23(17-24)21-9-7-20(8-10-21)19-33-16-15-32-3/h4-10,17,22,25H,11-16,18-19H2,1-3H3,(H,30,31) |
| InChIKey | BTAWAIRGFDEHQQ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|