C12H14F2O3 — CID 118254959
1-(difluoromethoxy)-2,3-dimethoxy-5-prop-2-enylbenzene (PubChem CID 118254959) has the molecular formula C12H14F2O3 and a molecular weight of 244.24 g/mol. Its IUPAC name is 1-(difluoromethoxy)-2,3-dimethoxy-5-prop-2-enylbenzene.
| Compound Name | 1-(difluoromethoxy)-2,3-dimethoxy-5-prop-2-enylbenzene |
|---|---|
| PubChem CID | 118254959 |
| Molecular Formula | C12H14F2O3 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 1-(difluoromethoxy)-2,3-dimethoxy-5-prop-2-enylbenzene |
| SMILES | C=CCc1cc(OC)c(OC)c(OC(F)F)c1 |
| InChI | InChI=1S/C12H14F2O3/c1-4-5-8-6-9(15-2)11(16-3)10(7-8)17-12(13)14/h4,6-7,12H,1,5H2,2-3H3 |
| InChIKey | HVPUOYCTWMFGKX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|