C7H6N8S — CID 118257072
5-[3-methyl-5-(2H-tetrazol-5-yl)thiophen-2-yl]-2H-tetrazole (PubChem CID 118257072) has the molecular formula C7H6N8S and a molecular weight of 234.25 g/mol. Its IUPAC name is 5-[3-methyl-5-(2H-tetrazol-5-yl)thiophen-2-yl]-2H-tetrazole.
| Compound Name | 5-[3-methyl-5-(2H-tetrazol-5-yl)thiophen-2-yl]-2H-tetrazole |
|---|---|
| PubChem CID | 118257072 |
| Molecular Formula | C7H6N8S |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | 5-[3-methyl-5-(2H-tetrazol-5-yl)thiophen-2-yl]-2H-tetrazole |
| SMILES | Cc1cc(-c2nn[nH]n2)sc1-c1nn[nH]n1 |
| InChI | InChI=1S/C7H6N8S/c1-3-2-4(6-8-12-13-9-6)16-5(3)7-10-14-15-11-7/h2H,1H3,(H,8,9,12,13)(H,10,11,14,15) |
| InChIKey | OZZVKYDGWKRFBP-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |