C22H28N6O2 — CID 11825714
6-imidazol-1-yl-2-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]pyridazin-3-one (PubChem CID 11825714) has the molecular formula C22H28N6O2 and a molecular weight of 408.51 g/mol. Its IUPAC name is 6-imidazol-1-yl-2-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]pyridazin-3-one.
| Compound Name | 6-imidazol-1-yl-2-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]pyridazin-3-one |
|---|---|
| PubChem CID | 11825714 |
| Molecular Formula | C22H28N6O2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 6-imidazol-1-yl-2-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]pyridazin-3-one |
| SMILES | COc1ccccc1N1CCN(CCCCn2nc(-n3ccnc3)ccc2=O)CC1 |
| InChI | InChI=1S/C22H28N6O2/c1-30-20-7-3-2-6-19(20)26-16-14-25(15-17-26)11-4-5-12-28-22(29)9-8-21(24-28)27-13-10-23-18-27/h2-3,6-10,13,18H,4-5,11-12,14-17H2,1H3 |
| InChIKey | BBYFUQNIDXWHPJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 68.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|