C23H31N5O3 — CID 53023453
2-[2-(azepan-1-yl)-2-oxoethyl]-6-[4-(2-methoxyphenyl)piperazin-1-yl]pyridazin-3-one (PubChem CID 53023453) has the molecular formula C23H31N5O3 and a molecular weight of 425.53 g/mol. Its IUPAC name is 2-[2-(azepan-1-yl)-2-oxoethyl]-6-[4-(2-methoxyphenyl)piperazin-1-yl]pyridazin-3-one.
| Compound Name | 2-[2-(azepan-1-yl)-2-oxoethyl]-6-[4-(2-methoxyphenyl)piperazin-1-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 53023453 |
| Molecular Formula | C23H31N5O3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | 2-[2-(azepan-1-yl)-2-oxoethyl]-6-[4-(2-methoxyphenyl)piperazin-1-yl]pyridazin-3-one |
| SMILES | COc1ccccc1N1CCN(c2ccc(=O)n(CC(=O)N3CCCCCC3)n2)CC1 |
| InChI | InChI=1S/C23H31N5O3/c1-31-20-9-5-4-8-19(20)25-14-16-26(17-15-25)21-10-11-22(29)28(24-21)18-23(30)27-12-6-2-3-7-13-27/h4-5,8-11H,2-3,6-7,12-18H2,1H3 |
| InChIKey | PGHKGWSMGXKMPP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 70.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |