C32H41ClN2O8 — CID 118258187
[(16E,18E)-11-chloro-21-hydroxy-2,5,9,12,16,20-hexamethyl-8,23-dioxo-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaen-6-yl] 3-oxobutanoate (PubChem CID 118258187) has the molecular formula C32H41ClN2O8 and a molecular weight of 617.14 g/mol. Its IUPAC name is [(16E,18E)-11-chloro-21-hydroxy-2,5,9,12,16,20-hexamethyl-8,23-dioxo-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaen-6-yl] 3-oxobutanoate.
| Compound Name | [(16E,18E)-11-chloro-21-hydroxy-2,5,9,12,16,20-hexamethyl-8,23-dioxo-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaen-6-yl] 3-oxobutanoate |
|---|---|
| PubChem CID | 118258187 |
| Molecular Formula | C32H41ClN2O8 |
| Molecular Weight | 617.14 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | [(16E,18E)-11-chloro-21-hydroxy-2,5,9,12,16,20-hexamethyl-8,23-dioxo-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaen-6-yl] 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)OC1CC(=O)N(C)c2cc(cc(C)c2Cl)C/C(C)=C/C=C/C(C)C2(O)CC(OC(=O)N2)C(C)C2OC12C |
| InChI | InChI=1S/C32H41ClN2O8/c1-17-9-8-10-19(3)32(40)16-24(41-30(39)34-32)21(5)29-31(6,43-29)25(42-27(38)13-20(4)36)15-26(37)35(7)23-14-22(11-17)12-18(2)28(23)33/h8-10,12,14,19,21,24-25,29,40H,11,13,15-16H2,1-7H3,(H,34,39)/b10-8+,17-9+ |
| InChIKey | DPSMXPYXZIMAMX-CCLXQDPASA-N |
| XLogP | 4.57 |
| TPSA | 134.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.14 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|