C31H42ClN3O7 — CID 118258185
[(16E,18E)-11-chloro-21-hydroxy-2,5,9,12,16,20-hexamethyl-8,23-dioxo-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaen-6-yl] 3-aminopropanoate (PubChem CID 118258185) has the molecular formula C31H42ClN3O7 and a molecular weight of 604.14 g/mol. Its IUPAC name is [(16E,18E)-11-chloro-21-hydroxy-2,5,9,12,16,20-hexamethyl-8,23-dioxo-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaen-6-yl] 3-aminopropanoate.
| Compound Name | [(16E,18E)-11-chloro-21-hydroxy-2,5,9,12,16,20-hexamethyl-8,23-dioxo-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaen-6-yl] 3-aminopropanoate |
|---|---|
| PubChem CID | 118258185 |
| Molecular Formula | C31H42ClN3O7 |
| Molecular Weight | 604.14 g/mol |
| Exact Mass | 603.27 |
| IUPAC Name | [(16E,18E)-11-chloro-21-hydroxy-2,5,9,12,16,20-hexamethyl-8,23-dioxo-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaen-6-yl] 3-aminopropanoate |
| SMILES | C/C1=C\C=C\C(C)C2(O)CC(OC(=O)N2)C(C)C2OC2(C)C(OC(=O)CCN)CC(=O)N(C)c2cc(cc(C)c2Cl)C1 |
| InChI | InChI=1S/C31H42ClN3O7/c1-17-8-7-9-19(3)31(39)16-23(40-29(38)34-31)20(4)28-30(5,42-28)24(41-26(37)10-11-33)15-25(36)35(6)22-14-21(12-17)13-18(2)27(22)32/h7-9,13-14,19-20,23-24,28,39H,10-12,15-16,33H2,1-6H3,(H,34,38)/b9-7+,17-8+ |
| InChIKey | FNRYDHCRJCJCJV-BVKBTSTHSA-N |
| XLogP | 3.94 |
| TPSA | 143.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.14 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|