C30H38BrClN2O9 — CID 5111652
(11-chloro-21-hydroxy-12,20-dimethoxy-2,5,9,16-tetramethyl-8,23-dioxo-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaen-6-yl) 2-bromoacetate (PubChem CID 5111652) has the molecular formula C30H38BrClN2O9 and a molecular weight of 686.00 g/mol. Its IUPAC name is (11-chloro-21-hydroxy-12,20-dimethoxy-2,5,9,16-tetramethyl-8,23-dioxo-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaen-6-yl) 2-bromoacetate.
| Compound Name | (11-chloro-21-hydroxy-12,20-dimethoxy-2,5,9,16-tetramethyl-8,23-dioxo-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaen-6-yl) 2-bromoacetate |
|---|---|
| PubChem CID | 5111652 |
| Molecular Formula | C30H38BrClN2O9 |
| Molecular Weight | 686.00 g/mol |
| Exact Mass | 684.14 |
| IUPAC Name | (11-chloro-21-hydroxy-12,20-dimethoxy-2,5,9,16-tetramethyl-8,23-dioxo-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaen-6-yl) 2-bromoacetate |
| SMILES | COc1cc2cc(c1Cl)N(C)C(=O)CC(OC(=O)CBr)C1(C)OC1C(C)C1CC(O)(NC(=O)O1)C(OC)C=CC=C(C)C2 |
| InChI | InChI=1S/C30H38BrClN2O9/c1-16-8-7-9-22(40-6)30(38)14-21(41-28(37)33-30)17(2)27-29(3,43-27)23(42-25(36)15-31)13-24(35)34(4)19-11-18(10-16)12-20(39-5)26(19)32/h7-9,11-12,17,21-23,27,38H,10,13-15H2,1-6H3,(H,33,37) |
| InChIKey | ARSBDDBVQBQVHY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 136.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.00 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|