C30H36ClF3N2O9 — CID 5358489
[(16E,18E)-11-chloro-21-hydroxy-12,20-dimethoxy-2,5,9,16-tetramethyl-8,23-dioxo-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaen-6-yl] 2,2,2-trifluoroacetate (PubChem CID 5358489) has the molecular formula C30H36ClF3N2O9 and a molecular weight of 661.07 g/mol. Its IUPAC name is [(16E,18E)-11-chloro-21-hydroxy-12,20-dimethoxy-2,5,9,16-tetramethyl-8,23-dioxo-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaen-6-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(16E,18E)-11-chloro-21-hydroxy-12,20-dimethoxy-2,5,9,16-tetramethyl-8,23-dioxo-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaen-6-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 5358489 |
| Molecular Formula | C30H36ClF3N2O9 |
| Molecular Weight | 661.07 g/mol |
| Exact Mass | 660.21 |
| IUPAC Name | [(16E,18E)-11-chloro-21-hydroxy-12,20-dimethoxy-2,5,9,16-tetramethyl-8,23-dioxo-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaen-6-yl] 2,2,2-trifluoroacetate |
| SMILES | COc1cc2cc(c1Cl)N(C)C(=O)CC(OC(=O)C(F)(F)F)C1(C)OC1C(C)C1CC(O)(NC(=O)O1)C(OC)/C=C/C=C(\C)C2 |
| InChI | InChI=1S/C30H36ClF3N2O9/c1-15-8-7-9-21(42-6)29(40)14-20(43-27(39)35-29)16(2)25-28(3,45-25)22(44-26(38)30(32,33)34)13-23(37)36(4)18-11-17(10-15)12-19(41-5)24(18)31/h7-9,11-12,16,20-22,25,40H,10,13-14H2,1-6H3,(H,35,39)/b9-7+,15-8+ |
| InChIKey | KQSXRTCEGYPPKF-KZVYIGENSA-N |
| XLogP | 4.23 |
| TPSA | 136.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.07 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|