C10H16N2 — CID 118259104
5-tert-butyl-3-prop-1-en-2-yl-1H-pyrazole (PubChem CID 118259104) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 5-tert-butyl-3-prop-1-en-2-yl-1H-pyrazole.
| Compound Name | 5-tert-butyl-3-prop-1-en-2-yl-1H-pyrazole |
|---|---|
| PubChem CID | 118259104 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 5-tert-butyl-3-prop-1-en-2-yl-1H-pyrazole |
| SMILES | C=C(C)c1cc(C(C)(C)C)[nH]n1 |
| InChI | InChI=1S/C10H16N2/c1-7(2)8-6-9(12-11-8)10(3,4)5/h6H,1H2,2-5H3,(H,11,12) |
| InChIKey | AVCQXXITAPHYTG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |