C16H24N2O4S — CID 118259909
2-[2-[2-(2,2-dimethylpropanoyloxy)ethyl]-2-tritiooxyhydrazinyl]-3-phenylpropanethioic S-acid (PubChem CID 118259909) has the molecular formula C16H24N2O4S and a molecular weight of 342.45 g/mol. Its IUPAC name is 2-[2-[2-(2,2-dimethylpropanoyloxy)ethyl]-2-tritiooxyhydrazinyl]-3-phenylpropanethioic S-acid.
| Compound Name | 2-[2-[2-(2,2-dimethylpropanoyloxy)ethyl]-2-tritiooxyhydrazinyl]-3-phenylpropanethioic S-acid |
|---|---|
| PubChem CID | 118259909 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 2-[2-[2-(2,2-dimethylpropanoyloxy)ethyl]-2-tritiooxyhydrazinyl]-3-phenylpropanethioic S-acid |
| SMILES | [3H]ON(CCOC(=O)C(C)(C)C)NC(Cc1ccccc1)C(=O)S |
| InChI | InChI=1S/C16H24N2O4S/c1-16(2,3)15(20)22-10-9-18(21)17-13(14(19)23)11-12-7-5-4-6-8-12/h4-8,13,17,21H,9-11H2,1-3H3,(H,19,23)/i21T |
| InChIKey | XIIURHAPZCBGBG-OSYFUQCMSA-N |
| XLogP | 1.84 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|