C40H69NO12S2 — CID 118260606
3-O-hexyl 5-O-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl] 1-O-[2-(pyridin-2-yldisulfanyl)ethyl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 118260606) has the molecular formula C40H69NO12S2 and a molecular weight of 820.12 g/mol. Its IUPAC name is 3-O-hexyl 5-O-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl] 1-O-[2-(pyridin-2-yldisulfanyl)ethyl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 3-O-hexyl 5-O-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl] 1-O-[2-(pyridin-2-yldisulfanyl)ethyl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 118260606 |
| Molecular Formula | C40H69NO12S2 |
| Molecular Weight | 820.12 g/mol |
| Exact Mass | 819.43 |
| IUPAC Name | 3-O-hexyl 5-O-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl] 1-O-[2-(pyridin-2-yldisulfanyl)ethyl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCCCCCOC(=O)C(C)(CC(C)(C)C(=O)OCCSSc1ccccn1)CC(C)(CC)C(=O)OCCOCCOCCOCCOCCOCCOC |
| InChI | InChI=1S/C40H69NO12S2/c1-8-10-11-14-17-51-37(44)40(6,32-38(3,4)35(42)53-30-31-54-55-34-15-12-13-16-41-34)33-39(5,9-2)36(43)52-29-28-50-27-26-49-25-24-48-23-22-47-21-20-46-19-18-45-7/h12-13,15-16H,8-11,14,17-33H2,1-7H3 |
| InChIKey | MKKKXMFGNXDNJH-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 147.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.12 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|