C26H27NOS2 — CID 11826201
(Z)-2-[5-tert-butyl-2,4-bis(phenylsulfanyl)cyclopenta-1,4-dien-1-yl]-3-ethoxyprop-2-enenitrile (PubChem CID 11826201) has the molecular formula C26H27NOS2 and a molecular weight of 433.64 g/mol. Its IUPAC name is (Z)-2-[5-tert-butyl-2,4-bis(phenylsulfanyl)cyclopenta-1,4-dien-1-yl]-3-ethoxyprop-2-enenitrile.
| Compound Name | (Z)-2-[5-tert-butyl-2,4-bis(phenylsulfanyl)cyclopenta-1,4-dien-1-yl]-3-ethoxyprop-2-enenitrile |
|---|---|
| PubChem CID | 11826201 |
| Molecular Formula | C26H27NOS2 |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | (Z)-2-[5-tert-butyl-2,4-bis(phenylsulfanyl)cyclopenta-1,4-dien-1-yl]-3-ethoxyprop-2-enenitrile |
| SMILES | CCO/C=C(\C#N)C1=C(Sc2ccccc2)CC(Sc2ccccc2)=C1C(C)(C)C |
| InChI | InChI=1S/C26H27NOS2/c1-5-28-18-19(17-27)24-22(29-20-12-8-6-9-13-20)16-23(25(24)26(2,3)4)30-21-14-10-7-11-15-21/h6-15,18H,5,16H2,1-4H3/b19-18+ |
| InChIKey | TXXGSWFODBDFDL-VHEBQXMUSA-N |
| XLogP | 7.97 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|