C26H29NO2S2 — CID 11123247
(2Z,3Z,6E)-2-(2,2-dimethylpropylidene)-7-ethoxy-5-hydroxy-4,6-bis(phenylsulfanyl)hepta-3,6-dienenitrile (PubChem CID 11123247) has the molecular formula C26H29NO2S2 and a molecular weight of 451.66 g/mol. Its IUPAC name is (2Z,3Z,6E)-2-(2,2-dimethylpropylidene)-7-ethoxy-5-hydroxy-4,6-bis(phenylsulfanyl)hepta-3,6-dienenitrile.
| Compound Name | (2Z,3Z,6E)-2-(2,2-dimethylpropylidene)-7-ethoxy-5-hydroxy-4,6-bis(phenylsulfanyl)hepta-3,6-dienenitrile |
|---|---|
| PubChem CID | 11123247 |
| Molecular Formula | C26H29NO2S2 |
| Molecular Weight | 451.66 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | (2Z,3Z,6E)-2-(2,2-dimethylpropylidene)-7-ethoxy-5-hydroxy-4,6-bis(phenylsulfanyl)hepta-3,6-dienenitrile |
| SMILES | CCO/C=C(/Sc1ccccc1)C(O)/C(=C/C(C#N)=C/C(C)(C)C)Sc1ccccc1 |
| InChI | InChI=1S/C26H29NO2S2/c1-5-29-19-24(31-22-14-10-7-11-15-22)25(28)23(30-21-12-8-6-9-13-21)16-20(18-27)17-26(2,3)4/h6-17,19,25,28H,5H2,1-4H3/b20-17-,23-16-,24-19+ |
| InChIKey | HATOUPATHKGGGW-HDRSYLLLSA-N |
| XLogP | 7.19 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.66 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|