C25H31ClN10O2 — CID 118263008
1-[4-[2-chloro-3-[[4-(cyclopropylamino)-7-methanimidoylimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-methanimidoylphenyl]piperazin-1-yl]-2-propoxyethanone (PubChem CID 118263008) has the molecular formula C25H31ClN10O2 and a molecular weight of 539.04 g/mol. Its IUPAC name is 1-[4-[2-chloro-3-[[4-(cyclopropylamino)-7-methanimidoylimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-methanimidoylphenyl]piperazin-1-yl]-2-propoxyethanone.
| Compound Name | 1-[4-[2-chloro-3-[[4-(cyclopropylamino)-7-methanimidoylimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-methanimidoylphenyl]piperazin-1-yl]-2-propoxyethanone |
|---|---|
| PubChem CID | 118263008 |
| Molecular Formula | C25H31ClN10O2 |
| Molecular Weight | 539.04 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | 1-[4-[2-chloro-3-[[4-(cyclopropylamino)-7-methanimidoylimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-methanimidoylphenyl]piperazin-1-yl]-2-propoxyethanone |
| SMILES | [H]/N=C/c1cc(Nc2nc(NC3CC3)c3ncc(/C=N/[H])n3n2)c(Cl)c(N2CCN(C(=O)COCCC)CC2)c1 |
| InChI | InChI=1S/C25H31ClN10O2/c1-2-9-38-15-21(37)35-7-5-34(6-8-35)20-11-16(12-27)10-19(22(20)26)31-25-32-23(30-17-3-4-17)24-29-14-18(13-28)36(24)33-25/h10-14,17,27-28H,2-9,15H2,1H3,(H2,30,31,32,33)/b27-12+,28-13+ |
| InChIKey | DRFHQHVZJDAZOC-ZDMXEENZSA-N |
| XLogP | 3.17 |
| TPSA | 147.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.04 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|