C25H30ClF2N11O2 — CID 130371831
methyl N-[(3R,4S)-1-[2-chloro-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-(methylamino)phenyl]-3-(2,2-difluoroethylamino)piperidin-4-yl]carbamate (PubChem CID 130371831) has the molecular formula C25H30ClF2N11O2 and a molecular weight of 590.04 g/mol. Its IUPAC name is methyl N-[(3R,4S)-1-[2-chloro-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-(methylamino)phenyl]-3-(2,2-difluoroethylamino)piperidin-4-yl]carbamate.
| Compound Name | methyl N-[(3R,4S)-1-[2-chloro-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-(methylamino)phenyl]-3-(2,2-difluoroethylamino)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 130371831 |
| Molecular Formula | C25H30ClF2N11O2 |
| Molecular Weight | 590.04 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | methyl N-[(3R,4S)-1-[2-chloro-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-(methylamino)phenyl]-3-(2,2-difluoroethylamino)piperidin-4-yl]carbamate |
| SMILES | CNc1cc(Nc2nc(NC3CC3)c3ncc(C#N)n3n2)c(Cl)c(N2CC[C@H](NC(=O)OC)[C@H](NCC(F)F)C2)c1 |
| InChI | InChI=1S/C25H30ClF2N11O2/c1-30-14-7-17(34-24-36-22(33-13-3-4-13)23-32-10-15(9-29)39(23)37-24)21(26)19(8-14)38-6-5-16(35-25(40)41-2)18(12-38)31-11-20(27)28/h7-8,10,13,16,18,20,30-31H,3-6,11-12H2,1-2H3,(H,35,40)(H2,33,34,36,37)/t16-,18+/m0/s1 |
| InChIKey | PQFPLTVARAGHOW-FUHWJXTLSA-N |
| XLogP | 3.17 |
| TPSA | 156.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.04 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|