C26H28ClN11O3 — CID 118263084
methyl N-[(3R,4S)-1-[1-[2-chloro-5-cyano-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]azetidin-3-yl]-4-methoxypyrrolidin-3-yl]carbamate (PubChem CID 118263084) has the molecular formula C26H28ClN11O3 and a molecular weight of 578.04 g/mol. Its IUPAC name is methyl N-[(3R,4S)-1-[1-[2-chloro-5-cyano-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]azetidin-3-yl]-4-methoxypyrrolidin-3-yl]carbamate.
| Compound Name | methyl N-[(3R,4S)-1-[1-[2-chloro-5-cyano-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]azetidin-3-yl]-4-methoxypyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 118263084 |
| Molecular Formula | C26H28ClN11O3 |
| Molecular Weight | 578.04 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | methyl N-[(3R,4S)-1-[1-[2-chloro-5-cyano-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]azetidin-3-yl]-4-methoxypyrrolidin-3-yl]carbamate |
| SMILES | COC(=O)N[C@@H]1CN(C2CN(c3cc(C#N)cc(Nc4nc(NC5CC5)c5ncc(C#N)n5n4)c3Cl)C2)C[C@@H]1OC |
| InChI | InChI=1S/C26H28ClN11O3/c1-40-21-13-36(12-19(21)33-26(39)41-2)17-10-37(11-17)20-6-14(7-28)5-18(22(20)27)32-25-34-23(31-15-3-4-15)24-30-9-16(8-29)38(24)35-25/h5-6,9,15,17,19,21H,3-4,10-13H2,1-2H3,(H,33,39)(H2,31,32,34,35)/t19-,21+/m1/s1 |
| InChIKey | FFYXOTDDKGIGNJ-CTNGQTDRSA-N |
| XLogP | 2.08 |
| TPSA | 168.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.04 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|